C12H16BrNS — CID 71472970
4-bromo-2-[(2S,3E,5E)-7-methylocta-3,5-dien-2-yl]-1,3-thiazole (PubChem CID 71472970) has the molecular formula C12H16BrNS and a molecular weight of 286.24 g/mol. Its IUPAC name is 4-bromo-2-[(2S,3E,5E)-7-methylocta-3,5-dien-2-yl]-1,3-thiazole.
| Compound Name | 4-bromo-2-[(2S,3E,5E)-7-methylocta-3,5-dien-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 71472970 |
| Molecular Formula | C12H16BrNS |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 4-bromo-2-[(2S,3E,5E)-7-methylocta-3,5-dien-2-yl]-1,3-thiazole |
| SMILES | CC(C)/C=C/C=C/[C@H](C)c1nc(Br)cs1 |
| InChI | InChI=1S/C12H16BrNS/c1-9(2)6-4-5-7-10(3)12-14-11(13)8-15-12/h4-10H,1-3H3/b6-4+,7-5+/t10-/m0/s1 |
| InChIKey | KEUIVXIUTNHIMU-RFPIMEFYSA-N |
| XLogP | 4.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|