About propan-2-yl (2S)-2-[[(2S)-2-(3,5-difluorophenyl)-2-(methoxymethoxy)acetyl]amino]propanoate
propan-2-yl (2S)-2-[[(2S)-2-(3,5-difluorophenyl)-2-(methoxymethoxy)acetyl]amino]propanoate (PubChem CID 71473118) has the molecular formula C16H21F2NO5
and a molecular weight of 345.34 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(2S)-2-(3,5-difluorophenyl)-2-(methoxymethoxy)acetyl]amino]propanoate.
Molecular Properties
| Compound Name | propan-2-yl (2S)-2-[[(2S)-2-(3,5-difluorophenyl)-2-(methoxymethoxy)acetyl]amino]propanoate |
| PubChem CID | 71473118 |
| Molecular Formula | C16H21F2NO5 |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | propan-2-yl (2S)-2-[[(2S)-2-(3,5-difluorophenyl)-2-(methoxymethoxy)acetyl]amino]propanoate |
| SMILES | COCO[C@H](C(=O)N[C@@H](C)C(=O)OC(C)C)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H21F2NO5/c1-9(2)24-16(21)10(3)19-15(20)14(23-8-22-4)11-5-12(17)7-13(18)6-11/h5-7,9-10,14H,8H2,1-4H3,(H,19,20)/t10-,14-/m0/s1 |
| InChIKey | QBTCMXGELZOYDE-HZMBPMFUSA-N |
| XLogP | 2.08 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl (2S)-2-[[(2S)-2-(3,5-difluorophenyl)-2-(methoxymethoxy)acetyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (2S)-2-[[(2S)-2-(3,5-difluorophenyl)-2-(methoxymethoxy)acetyl]amino]propanoate?
The IUPAC name of propan-2-yl (2S)-2-[[(2S)-2-(3,5-difluorophenyl)-2-(methoxymethoxy)acetyl]amino]propanoate (CID 71473118) is propan-2-yl (2S)-2-[[(2S)-2-(3,5-difluorophenyl)-2-(methoxymethoxy)acetyl]amino]propanoate.
What is the SMILES notation for propan-2-yl (2S)-2-[[(2S)-2-(3,5-difluorophenyl)-2-(methoxymethoxy)acetyl]amino]propanoate?
The canonical SMILES for propan-2-yl (2S)-2-[[(2S)-2-(3,5-difluorophenyl)-2-(methoxymethoxy)acetyl]amino]propanoate is COCO[C@H](C(=O)N[C@@H](C)C(=O)OC(C)C)c1cc(F)cc(F)c1.
What is the InChIKey of propan-2-yl (2S)-2-[[(2S)-2-(3,5-difluorophenyl)-2-(methoxymethoxy)acetyl]amino]propanoate?
The InChIKey is QBTCMXGELZOYDE-HZMBPMFUSA-N. The full InChI is InChI=1S/C16H21F2NO5/c1-9(2)24-16(21)10(3)19-15(20)14(23-8-22-4)11-5-12(17)7-13(18)6-11/h5-7,9-10,14H,8H2,1-4H3,(H,19,20)/t10-,14-/m0/s1.
What are the key properties of propan-2-yl (2S)-2-[[(2S)-2-(3,5-difluorophenyl)-2-(methoxymethoxy)acetyl]amino]propanoate?
propan-2-yl (2S)-2-[[(2S)-2-(3,5-difluorophenyl)-2-(methoxymethoxy)acetyl]amino]propanoate has a molecular weight of 345.34 g/mol, XLogP of 2.08, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (2S)-2-[[(2S)-2-(3,5-difluorophenyl)-2-(methoxymethoxy)acetyl]amino]propanoate is sourced from PubChem (CID 71473118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).