C15H31NO2Si — CID 71473120
(E,3R,4S)-1-(1,3-dioxan-2-yl)-4-methyl-7-trimethylsilylhept-5-en-3-amine (PubChem CID 71473120) has the molecular formula C15H31NO2Si and a molecular weight of 285.50 g/mol. Its IUPAC name is (E,3R,4S)-1-(1,3-dioxan-2-yl)-4-methyl-7-trimethylsilylhept-5-en-3-amine.
| Compound Name | (E,3R,4S)-1-(1,3-dioxan-2-yl)-4-methyl-7-trimethylsilylhept-5-en-3-amine |
|---|---|
| PubChem CID | 71473120 |
| Molecular Formula | C15H31NO2Si |
| Molecular Weight | 285.50 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | (E,3R,4S)-1-(1,3-dioxan-2-yl)-4-methyl-7-trimethylsilylhept-5-en-3-amine |
| SMILES | C[C@@H](/C=C/C[Si](C)(C)C)[C@H](N)CCC1OCCCO1 |
| InChI | InChI=1S/C15H31NO2Si/c1-13(7-5-12-19(2,3)4)14(16)8-9-15-17-10-6-11-18-15/h5,7,13-15H,6,8-12,16H2,1-4H3/b7-5+/t13-,14+/m0/s1 |
| InChIKey | RZAFODLWVWCYNR-CXSYMGSUSA-N |
| XLogP | 3.39 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|