C11H15N7O7 — CID 71473543
(2R,3R,4S)-3-[(2-azidoacetyl)amino]-2-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 71473543) has the molecular formula C11H15N7O7 and a molecular weight of 357.28 g/mol. Its IUPAC name is (2R,3R,4S)-3-[(2-azidoacetyl)amino]-2-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-3-[(2-azidoacetyl)amino]-2-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 71473543 |
| Molecular Formula | C11H15N7O7 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (2R,3R,4S)-3-[(2-azidoacetyl)amino]-2-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | [N-]=[N+]=NCC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CN=[N+]=[N-])OC(C(=O)O)=C[C@@H]1O |
| InChI | InChI=1S/C11H15N7O7/c12-17-14-2-5(20)9(22)10-8(16-7(21)3-15-18-13)4(19)1-6(25-10)11(23)24/h1,4-5,8-10,19-20,22H,2-3H2,(H,16,21)(H,23,24)/t4-,5+,8+,9+,10+/m0/s1 |
| InChIKey | AVDBZBDBFJBQOS-NCJYIMSCSA-N |
| XLogP | -1.46 |
| TPSA | 233.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|