About 2-[(2-aminoacetyl)amino]acetate;2-methyl-4-oxopyran-3-olate;nickel(2+)
2-[(2-aminoacetyl)amino]acetate;2-methyl-4-oxopyran-3-olate;nickel(2+) (PubChem CID 71473778) has the molecular formula C10H12N2NiO6
and a molecular weight of 314.91 g/mol. Its IUPAC name is 2-[(2-aminoacetyl)amino]acetate;2-methyl-4-oxopyran-3-olate;nickel(2+).
Molecular Properties
| Compound Name | 2-[(2-aminoacetyl)amino]acetate;2-methyl-4-oxopyran-3-olate;nickel(2+) |
| PubChem CID | 71473778 |
| Molecular Formula | C10H12N2NiO6 |
| Molecular Weight | 314.91 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 2-[(2-aminoacetyl)amino]acetate;2-methyl-4-oxopyran-3-olate;nickel(2+) |
| SMILES | Cc1occc(=O)c1[O-].NCC(=O)NCC(=O)[O-].[Ni+2] |
| InChI | InChI=1S/C6H6O3.C4H8N2O3.Ni/c1-4-6(8)5(7)2-3-9-4;5-1-3(7)6-2-4(8)9;/h2-3,8H,1H3;1-2,5H2,(H,6,7)(H,8,9);/q;;+2/p-2 |
| InChIKey | AFKCAFWBUPVJJY-UHFFFAOYSA-L |
| XLogP | -3.17 |
| TPSA | 148.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.91 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[(2-aminoacetyl)amino]acetate;2-methyl-4-oxopyran-3-olate;nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-aminoacetyl)amino]acetate;2-methyl-4-oxopyran-3-olate;nickel(2+)?
The IUPAC name of 2-[(2-aminoacetyl)amino]acetate;2-methyl-4-oxopyran-3-olate;nickel(2+) (CID 71473778) is 2-[(2-aminoacetyl)amino]acetate;2-methyl-4-oxopyran-3-olate;nickel(2+).
What is the SMILES notation for 2-[(2-aminoacetyl)amino]acetate;2-methyl-4-oxopyran-3-olate;nickel(2+)?
The canonical SMILES for 2-[(2-aminoacetyl)amino]acetate;2-methyl-4-oxopyran-3-olate;nickel(2+) is Cc1occc(=O)c1[O-].NCC(=O)NCC(=O)[O-].[Ni+2].
What is the InChIKey of 2-[(2-aminoacetyl)amino]acetate;2-methyl-4-oxopyran-3-olate;nickel(2+)?
The InChIKey is AFKCAFWBUPVJJY-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H6O3.C4H8N2O3.Ni/c1-4-6(8)5(7)2-3-9-4;5-1-3(7)6-2-4(8)9;/h2-3,8H,1H3;1-2,5H2,(H,6,7)(H,8,9);/q;;+2/p-2.
What are the key properties of 2-[(2-aminoacetyl)amino]acetate;2-methyl-4-oxopyran-3-olate;nickel(2+)?
2-[(2-aminoacetyl)amino]acetate;2-methyl-4-oxopyran-3-olate;nickel(2+) has a molecular weight of 314.91 g/mol, XLogP of -3.17, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-aminoacetyl)amino]acetate;2-methyl-4-oxopyran-3-olate;nickel(2+) is sourced from PubChem (CID 71473778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).