C38H68O15 — CID 71474139
[(2R,3S,4S,5R,6R)-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)-2-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]oxan-3-yl] octanoate (PubChem CID 71474139) has the molecular formula C38H68O15 and a molecular weight of 764.95 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)-2-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]oxan-3-yl] octanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)-2-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]oxan-3-yl] octanoate |
|---|---|
| PubChem CID | 71474139 |
| Molecular Formula | C38H68O15 |
| Molecular Weight | 764.95 g/mol |
| Exact Mass | 764.46 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)-2-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]oxan-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@@H]1[C@H](OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)O[C@H](COC(=O)CCCCC)[C@@H](OC(=O)CCCCC)[C@@H]1OC(=O)CCCCC |
| InChI | InChI=1S/C38H68O15/c1-5-9-13-14-18-22-32(45)53-37-36(52-31(44)21-17-12-8-4)35(51-30(43)20-16-11-7-3)28(25-48-29(42)19-15-10-6-2)50-38(37)49-24-27(41)34(47)33(46)26(40)23-39/h26-28,33-41,46-47H,5-25H2,1-4H3/t26-,27-,28-,33-,34-,35-,36+,37+,38-/m1/s1 |
| InChIKey | KXOHHVVQXCNKBM-QDOWTLGRSA-N |
| XLogP | 3.54 |
| TPSA | 224.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.95 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|