C18H21NO7 — CID 71474640
ethyl (2S)-2-[(4R)-5,5-diacetyl-4-(4-methylphenyl)-2-oxido-4H-1,2-oxazol-2-ium-3-yl]-2-hydroxyacetate (PubChem CID 71474640) has the molecular formula C18H21NO7 and a molecular weight of 363.37 g/mol. Its IUPAC name is ethyl (2S)-2-[(4R)-5,5-diacetyl-4-(4-methylphenyl)-2-oxido-4H-1,2-oxazol-2-ium-3-yl]-2-hydroxyacetate.
| Compound Name | ethyl (2S)-2-[(4R)-5,5-diacetyl-4-(4-methylphenyl)-2-oxido-4H-1,2-oxazol-2-ium-3-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 71474640 |
| Molecular Formula | C18H21NO7 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | ethyl (2S)-2-[(4R)-5,5-diacetyl-4-(4-methylphenyl)-2-oxido-4H-1,2-oxazol-2-ium-3-yl]-2-hydroxyacetate |
| SMILES | CCOC(=O)[C@@H](O)C1=[N+]([O-])OC(C(C)=O)(C(C)=O)[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C18H21NO7/c1-5-25-17(23)16(22)15-14(13-8-6-10(2)7-9-13)18(11(3)20,12(4)21)26-19(15)24/h6-9,14,16,22H,5H2,1-4H3/t14-,16+/m1/s1 |
| InChIKey | XSMAMJRDOMGMJP-ZBFHGGJFSA-N |
| XLogP | 0.82 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|