C15H16N2O6 — CID 71474891
3-(4,5-dimethoxy-2-nitrophenyl)-1-oxido-3,5,6,7-tetrahydro-2,1-benzoxazol-1-ium (PubChem CID 71474891) has the molecular formula C15H16N2O6 and a molecular weight of 320.30 g/mol. Its IUPAC name is 3-(4,5-dimethoxy-2-nitrophenyl)-1-oxido-3,5,6,7-tetrahydro-2,1-benzoxazol-1-ium.
| Compound Name | 3-(4,5-dimethoxy-2-nitrophenyl)-1-oxido-3,5,6,7-tetrahydro-2,1-benzoxazol-1-ium |
|---|---|
| PubChem CID | 71474891 |
| Molecular Formula | C15H16N2O6 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 3-(4,5-dimethoxy-2-nitrophenyl)-1-oxido-3,5,6,7-tetrahydro-2,1-benzoxazol-1-ium |
| SMILES | COc1cc(C2O[N+]([O-])=C3CCCC=C32)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C15H16N2O6/c1-21-13-7-10(12(16(18)19)8-14(13)22-2)15-9-5-3-4-6-11(9)17(20)23-15/h5,7-8,15H,3-4,6H2,1-2H3 |
| InChIKey | YOHBYDDITRUPTL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 96.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|