C8H10F2O2 — CID 71474933
(2S)-1,1-difluoro-2-(5-methylfuran-2-yl)propan-2-ol (PubChem CID 71474933) has the molecular formula C8H10F2O2 and a molecular weight of 176.16 g/mol. Its IUPAC name is (2S)-1,1-difluoro-2-(5-methylfuran-2-yl)propan-2-ol.
| Compound Name | (2S)-1,1-difluoro-2-(5-methylfuran-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 71474933 |
| Molecular Formula | C8H10F2O2 |
| Molecular Weight | 176.16 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | (2S)-1,1-difluoro-2-(5-methylfuran-2-yl)propan-2-ol |
| SMILES | Cc1ccc([C@](C)(O)C(F)F)o1 |
| InChI | InChI=1S/C8H10F2O2/c1-5-3-4-6(12-5)8(2,11)7(9)10/h3-4,7,11H,1-2H3/t8-/m0/s1 |
| InChIKey | HSGKRFJFXQPYGZ-QMMMGPOBSA-N |
| XLogP | 2.06 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.16 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |