About N-buta-2,3-dienyl-4-fluorobenzamide
N-buta-2,3-dienyl-4-fluorobenzamide (PubChem CID 71475145) has the molecular formula C11H10FNO
and a molecular weight of 191.20 g/mol. Its IUPAC name is N-buta-2,3-dienyl-4-fluorobenzamide.
Molecular Properties
| Compound Name | N-buta-2,3-dienyl-4-fluorobenzamide |
| PubChem CID | 71475145 |
| Molecular Formula | C11H10FNO |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | N-buta-2,3-dienyl-4-fluorobenzamide |
| SMILES | C=C=CCNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H10FNO/c1-2-3-8-13-11(14)9-4-6-10(12)7-5-9/h3-7H,1,8H2,(H,13,14) |
| InChIKey | YMXBQIIPWIMAQE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-buta-2,3-dienyl-4-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-buta-2,3-dienyl-4-fluorobenzamide?
The IUPAC name of N-buta-2,3-dienyl-4-fluorobenzamide (CID 71475145) is N-buta-2,3-dienyl-4-fluorobenzamide.
What is the SMILES notation for N-buta-2,3-dienyl-4-fluorobenzamide?
The canonical SMILES for N-buta-2,3-dienyl-4-fluorobenzamide is C=C=CCNC(=O)c1ccc(F)cc1.
What is the InChIKey of N-buta-2,3-dienyl-4-fluorobenzamide?
The InChIKey is YMXBQIIPWIMAQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FNO/c1-2-3-8-13-11(14)9-4-6-10(12)7-5-9/h3-7H,1,8H2,(H,13,14).
What are the key properties of N-buta-2,3-dienyl-4-fluorobenzamide?
N-buta-2,3-dienyl-4-fluorobenzamide has a molecular weight of 191.20 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-buta-2,3-dienyl-4-fluorobenzamide is sourced from PubChem (CID 71475145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).