About N-buta-2,3-dienylpentanamide
N-buta-2,3-dienylpentanamide (PubChem CID 71475189) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is N-buta-2,3-dienylpentanamide.
Molecular Properties
| Compound Name | N-buta-2,3-dienylpentanamide |
| PubChem CID | 71475189 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | N-buta-2,3-dienylpentanamide |
| SMILES | C=C=CCNC(=O)CCCC |
| InChI | InChI=1S/C9H15NO/c1-3-5-7-9(11)10-8-6-4-2/h6H,2-3,5,7-8H2,1H3,(H,10,11) |
| InChIKey | NNNLOEOXANOUJW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-buta-2,3-dienylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-buta-2,3-dienylpentanamide?
The IUPAC name of N-buta-2,3-dienylpentanamide (CID 71475189) is N-buta-2,3-dienylpentanamide.
What is the SMILES notation for N-buta-2,3-dienylpentanamide?
The canonical SMILES for N-buta-2,3-dienylpentanamide is C=C=CCNC(=O)CCCC.
What is the InChIKey of N-buta-2,3-dienylpentanamide?
The InChIKey is NNNLOEOXANOUJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-3-5-7-9(11)10-8-6-4-2/h6H,2-3,5,7-8H2,1H3,(H,10,11).
What are the key properties of N-buta-2,3-dienylpentanamide?
N-buta-2,3-dienylpentanamide has a molecular weight of 153.22 g/mol, XLogP of 1.63, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-buta-2,3-dienylpentanamide is sourced from PubChem (CID 71475189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).