C23H35NO7Si — CID 71475342
ethyl (2S,3Z,4R)-5-acetyl-2-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3-hydroxyimino-6-oxo-4-phenylheptanoate (PubChem CID 71475342) has the molecular formula C23H35NO7Si and a molecular weight of 465.62 g/mol. Its IUPAC name is ethyl (2S,3Z,4R)-5-acetyl-2-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3-hydroxyimino-6-oxo-4-phenylheptanoate.
| Compound Name | ethyl (2S,3Z,4R)-5-acetyl-2-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3-hydroxyimino-6-oxo-4-phenylheptanoate |
|---|---|
| PubChem CID | 71475342 |
| Molecular Formula | C23H35NO7Si |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | ethyl (2S,3Z,4R)-5-acetyl-2-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3-hydroxyimino-6-oxo-4-phenylheptanoate |
| SMILES | CCOC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)/C(=N\O)[C@@H](c1ccccc1)C(O)(C(C)=O)C(C)=O |
| InChI | InChI=1S/C23H35NO7Si/c1-9-30-21(27)20(31-32(7,8)22(4,5)6)19(24-29)18(17-13-11-10-12-14-17)23(28,15(2)25)16(3)26/h10-14,18,20,28-29H,9H2,1-8H3/b24-19-/t18-,20+/m1/s1 |
| InChIKey | TZBPFRZUSNAJTO-KAMWQVSOSA-N |
| XLogP | 3.46 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|