C17H19NO7 — CID 71475385
ethyl (2S)-2-[(4R)-5,5-diacetyl-2-oxido-4-phenyl-4H-1,2-oxazol-2-ium-3-yl]-2-hydroxyacetate (PubChem CID 71475385) has the molecular formula C17H19NO7 and a molecular weight of 349.34 g/mol. Its IUPAC name is ethyl (2S)-2-[(4R)-5,5-diacetyl-2-oxido-4-phenyl-4H-1,2-oxazol-2-ium-3-yl]-2-hydroxyacetate.
| Compound Name | ethyl (2S)-2-[(4R)-5,5-diacetyl-2-oxido-4-phenyl-4H-1,2-oxazol-2-ium-3-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 71475385 |
| Molecular Formula | C17H19NO7 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | ethyl (2S)-2-[(4R)-5,5-diacetyl-2-oxido-4-phenyl-4H-1,2-oxazol-2-ium-3-yl]-2-hydroxyacetate |
| SMILES | CCOC(=O)[C@@H](O)C1=[N+]([O-])OC(C(C)=O)(C(C)=O)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H19NO7/c1-4-24-16(22)15(21)14-13(12-8-6-5-7-9-12)17(10(2)19,11(3)20)25-18(14)23/h5-9,13,15,21H,4H2,1-3H3/t13-,15+/m1/s1 |
| InChIKey | FYHNFOZTWGEYRI-HIFRSBDPSA-N |
| XLogP | 0.51 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|