C19H23NO — CID 71475915
2,2,7,7-tetramethyl-1-phenyl-6,8-dihydroquinolin-5-one (PubChem CID 71475915) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is 2,2,7,7-tetramethyl-1-phenyl-6,8-dihydroquinolin-5-one.
| Compound Name | 2,2,7,7-tetramethyl-1-phenyl-6,8-dihydroquinolin-5-one |
|---|---|
| PubChem CID | 71475915 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 2,2,7,7-tetramethyl-1-phenyl-6,8-dihydroquinolin-5-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(c1ccccc1)C(C)(C)C=C2 |
| InChI | InChI=1S/C19H23NO/c1-18(2)12-16-15(17(21)13-18)10-11-19(3,4)20(16)14-8-6-5-7-9-14/h5-11H,12-13H2,1-4H3 |
| InChIKey | FPDJPIINEHLOSH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |