C26H42O4S2 — CID 71476005
S-[4-[2-(4-acetylsulfanylbutyl)-4,5-bis(4-hydroxybutyl)phenyl]butyl] ethanethioate (PubChem CID 71476005) has the molecular formula C26H42O4S2 and a molecular weight of 482.75 g/mol. Its IUPAC name is S-[4-[2-(4-acetylsulfanylbutyl)-4,5-bis(4-hydroxybutyl)phenyl]butyl] ethanethioate.
| Compound Name | S-[4-[2-(4-acetylsulfanylbutyl)-4,5-bis(4-hydroxybutyl)phenyl]butyl] ethanethioate |
|---|---|
| PubChem CID | 71476005 |
| Molecular Formula | C26H42O4S2 |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | S-[4-[2-(4-acetylsulfanylbutyl)-4,5-bis(4-hydroxybutyl)phenyl]butyl] ethanethioate |
| SMILES | CC(=O)SCCCCc1cc(CCCCO)c(CCCCO)cc1CCCCSC(C)=O |
| InChI | InChI=1S/C26H42O4S2/c1-21(29)31-17-9-5-13-25-19-23(11-3-7-15-27)24(12-4-8-16-28)20-26(25)14-6-10-18-32-22(2)30/h19-20,27-28H,3-18H2,1-2H3 |
| InChIKey | OEJCWXZVTLCLNA-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|