C17H13FN4O9 — CID 71476070
(4-nitrophenyl) N-[5-fluoro-1-[(4R,6R)-6-methyl-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-oxopyrimidin-4-yl]carbamate (PubChem CID 71476070) has the molecular formula C17H13FN4O9 and a molecular weight of 436.31 g/mol. Its IUPAC name is (4-nitrophenyl) N-[5-fluoro-1-[(4R,6R)-6-methyl-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | (4-nitrophenyl) N-[5-fluoro-1-[(4R,6R)-6-methyl-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 71476070 |
| Molecular Formula | C17H13FN4O9 |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | (4-nitrophenyl) N-[5-fluoro-1-[(4R,6R)-6-methyl-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-oxopyrimidin-4-yl]carbamate |
| SMILES | C[C@H]1O[C@@H](n2cc(F)c(NC(=O)Oc3ccc([N+](=O)[O-])cc3)nc2=O)C2OC(=O)OC21 |
| InChI | InChI=1S/C17H13FN4O9/c1-7-11-12(31-17(25)30-11)14(28-7)21-6-10(18)13(19-15(21)23)20-16(24)29-9-4-2-8(3-5-9)22(26)27/h2-7,11-12,14H,1H3,(H,19,20,23,24)/t7-,11?,12?,14-/m1/s1 |
| InChIKey | JSEJBEZLXHMDDQ-JNDQFMRFSA-N |
| XLogP | 1.72 |
| TPSA | 161.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|