C11H16O2 — CID 71476228
(1R,4R,5R,7R)-5-(hydroxymethyl)-7-prop-2-enylbicyclo[2.2.1]hept-2-en-7-ol (PubChem CID 71476228) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (1R,4R,5R,7R)-5-(hydroxymethyl)-7-prop-2-enylbicyclo[2.2.1]hept-2-en-7-ol.
| Compound Name | (1R,4R,5R,7R)-5-(hydroxymethyl)-7-prop-2-enylbicyclo[2.2.1]hept-2-en-7-ol |
|---|---|
| PubChem CID | 71476228 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (1R,4R,5R,7R)-5-(hydroxymethyl)-7-prop-2-enylbicyclo[2.2.1]hept-2-en-7-ol |
| SMILES | C=CC[C@]1(O)[C@@H]2C=C[C@H]1C[C@H]2CO |
| InChI | InChI=1S/C11H16O2/c1-2-5-11(13)9-3-4-10(11)8(6-9)7-12/h2-4,8-10,12-13H,1,5-7H2/t8-,9-,10+,11+/m0/s1 |
| InChIKey | UEXIEHUMHWCWAX-UKKRHICBSA-N |
| XLogP | 1.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|