About [6-(hydroxymethyl)-1,2,4,5-tetrazin-3-yl]methanol
[6-(hydroxymethyl)-1,2,4,5-tetrazin-3-yl]methanol (PubChem CID 71476313) has the molecular formula C4H6N4O2
and a molecular weight of 142.12 g/mol. Its IUPAC name is [6-(hydroxymethyl)-1,2,4,5-tetrazin-3-yl]methanol.
Molecular Properties
| Compound Name | [6-(hydroxymethyl)-1,2,4,5-tetrazin-3-yl]methanol |
| PubChem CID | 71476313 |
| Molecular Formula | C4H6N4O2 |
| Molecular Weight | 142.12 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | [6-(hydroxymethyl)-1,2,4,5-tetrazin-3-yl]methanol |
| SMILES | OCc1nnc(CO)nn1 |
| InChI | InChI=1S/C4H6N4O2/c9-1-3-5-7-4(2-10)8-6-3/h9-10H,1-2H2 |
| InChIKey | WPHNNAOPAZZUPA-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.12 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [6-(hydroxymethyl)-1,2,4,5-tetrazin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(hydroxymethyl)-1,2,4,5-tetrazin-3-yl]methanol?
The IUPAC name of [6-(hydroxymethyl)-1,2,4,5-tetrazin-3-yl]methanol (CID 71476313) is [6-(hydroxymethyl)-1,2,4,5-tetrazin-3-yl]methanol.
What is the SMILES notation for [6-(hydroxymethyl)-1,2,4,5-tetrazin-3-yl]methanol?
The canonical SMILES for [6-(hydroxymethyl)-1,2,4,5-tetrazin-3-yl]methanol is OCc1nnc(CO)nn1.
What is the InChIKey of [6-(hydroxymethyl)-1,2,4,5-tetrazin-3-yl]methanol?
The InChIKey is WPHNNAOPAZZUPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4O2/c9-1-3-5-7-4(2-10)8-6-3/h9-10H,1-2H2.
What are the key properties of [6-(hydroxymethyl)-1,2,4,5-tetrazin-3-yl]methanol?
[6-(hydroxymethyl)-1,2,4,5-tetrazin-3-yl]methanol has a molecular weight of 142.12 g/mol, XLogP of -1.75, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(hydroxymethyl)-1,2,4,5-tetrazin-3-yl]methanol is sourced from PubChem (CID 71476313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).