C15H12N4O5 — CID 714768
N-(2,4-dioxo-1H-pyrimidin-5-yl)-4-(2,5-dioxopyrrolidin-1-yl)benzamide (PubChem CID 714768) has the molecular formula C15H12N4O5 and a molecular weight of 328.28 g/mol. Its IUPAC name is N-(2,4-dioxo-1H-pyrimidin-5-yl)-4-(2,5-dioxopyrrolidin-1-yl)benzamide.
| Compound Name | N-(2,4-dioxo-1H-pyrimidin-5-yl)-4-(2,5-dioxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 714768 |
| Molecular Formula | C15H12N4O5 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | N-(2,4-dioxo-1H-pyrimidin-5-yl)-4-(2,5-dioxopyrrolidin-1-yl)benzamide |
| SMILES | O=C(Nc1c[nH]c(=O)[nH]c1=O)c1ccc(N2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C15H12N4O5/c20-11-5-6-12(21)19(11)9-3-1-8(2-4-9)13(22)17-10-7-16-15(24)18-14(10)23/h1-4,7H,5-6H2,(H,17,22)(H2,16,18,23,24) |
| InChIKey | CGNUNNZXLIXABQ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 132.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|