About N-[3-[(E)-3-(3-bromo-2,4,6-trimethoxyphenyl)prop-2-enoyl]phenyl]-3-methylbenzamide
N-[3-[(E)-3-(3-bromo-2,4,6-trimethoxyphenyl)prop-2-enoyl]phenyl]-3-methylbenzamide (PubChem CID 71477053) has the molecular formula C26H24BrNO5
and a molecular weight of 510.38 g/mol. Its IUPAC name is N-[3-[(E)-3-(3-bromo-2,4,6-trimethoxyphenyl)prop-2-enoyl]phenyl]-3-methylbenzamide.
Molecular Properties
| Compound Name | N-[3-[(E)-3-(3-bromo-2,4,6-trimethoxyphenyl)prop-2-enoyl]phenyl]-3-methylbenzamide |
| PubChem CID | 71477053 |
| Molecular Formula | C26H24BrNO5 |
| Molecular Weight | 510.38 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | N-[3-[(E)-3-(3-bromo-2,4,6-trimethoxyphenyl)prop-2-enoyl]phenyl]-3-methylbenzamide |
| SMILES | COc1cc(OC)c(/C=C/C(=O)c2cccc(NC(=O)c3cccc(C)c3)c2)c(OC)c1Br |
| InChI | InChI=1S/C26H24BrNO5/c1-16-7-5-9-18(13-16)26(30)28-19-10-6-8-17(14-19)21(29)12-11-20-22(31-2)15-23(32-3)24(27)25(20)33-4/h5-15H,1-4H3,(H,28,30)/b12-11+ |
| InChIKey | CCLDBQDGCRDUAV-VAWYXSNFSA-N |
| XLogP | 5.93 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 510.38 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[(E)-3-(3-bromo-2,4,6-trimethoxyphenyl)prop-2-enoyl]phenyl]-3-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(E)-3-(3-bromo-2,4,6-trimethoxyphenyl)prop-2-enoyl]phenyl]-3-methylbenzamide?
The IUPAC name of N-[3-[(E)-3-(3-bromo-2,4,6-trimethoxyphenyl)prop-2-enoyl]phenyl]-3-methylbenzamide (CID 71477053) is N-[3-[(E)-3-(3-bromo-2,4,6-trimethoxyphenyl)prop-2-enoyl]phenyl]-3-methylbenzamide.
What is the SMILES notation for N-[3-[(E)-3-(3-bromo-2,4,6-trimethoxyphenyl)prop-2-enoyl]phenyl]-3-methylbenzamide?
The canonical SMILES for N-[3-[(E)-3-(3-bromo-2,4,6-trimethoxyphenyl)prop-2-enoyl]phenyl]-3-methylbenzamide is COc1cc(OC)c(/C=C/C(=O)c2cccc(NC(=O)c3cccc(C)c3)c2)c(OC)c1Br.
What is the InChIKey of N-[3-[(E)-3-(3-bromo-2,4,6-trimethoxyphenyl)prop-2-enoyl]phenyl]-3-methylbenzamide?
The InChIKey is CCLDBQDGCRDUAV-VAWYXSNFSA-N. The full InChI is InChI=1S/C26H24BrNO5/c1-16-7-5-9-18(13-16)26(30)28-19-10-6-8-17(14-19)21(29)12-11-20-22(31-2)15-23(32-3)24(27)25(20)33-4/h5-15H,1-4H3,(H,28,30)/b12-11+.
What are the key properties of N-[3-[(E)-3-(3-bromo-2,4,6-trimethoxyphenyl)prop-2-enoyl]phenyl]-3-methylbenzamide?
N-[3-[(E)-3-(3-bromo-2,4,6-trimethoxyphenyl)prop-2-enoyl]phenyl]-3-methylbenzamide has a molecular weight of 510.38 g/mol, XLogP of 5.93, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(E)-3-(3-bromo-2,4,6-trimethoxyphenyl)prop-2-enoyl]phenyl]-3-methylbenzamide is sourced from PubChem (CID 71477053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).