C25H22FN2O3+ — CID 71477432
4-fluoro-20-methyl-17-[(4-oxidomorpholin-4-ium-4-yl)methyl]-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaene (PubChem CID 71477432) has the molecular formula C25H22FN2O3+ and a molecular weight of 417.46 g/mol. Its IUPAC name is 4-fluoro-20-methyl-17-[(4-oxidomorpholin-4-ium-4-yl)methyl]-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaene.
| Compound Name | 4-fluoro-20-methyl-17-[(4-oxidomorpholin-4-ium-4-yl)methyl]-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 71477432 |
| Molecular Formula | C25H22FN2O3+ |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 4-fluoro-20-methyl-17-[(4-oxidomorpholin-4-ium-4-yl)methyl]-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaene |
| SMILES | C[n+]1c2c3c(cccc3c3ccc(C[N+]4([O-])CCOCC4)cc31)Oc1ccc(F)cc1-2 |
| InChI | InChI=1S/C25H22FN2O3/c1-27-21-13-16(15-28(29)9-11-30-12-10-28)5-7-18(21)19-3-2-4-23-24(19)25(27)20-14-17(26)6-8-22(20)31-23/h2-8,13-14H,9-12,15H2,1H3/q+1 |
| InChIKey | HKXRPGJIGJUGPQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|