C22H23ClN6OS — CID 71477495
(3E)-3-[(3-benzyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)imino]-5-chloro-1-(diethylaminomethyl)indol-2-one (PubChem CID 71477495) has the molecular formula C22H23ClN6OS and a molecular weight of 454.99 g/mol. Its IUPAC name is (3E)-3-[(3-benzyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)imino]-5-chloro-1-(diethylaminomethyl)indol-2-one.
| Compound Name | (3E)-3-[(3-benzyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)imino]-5-chloro-1-(diethylaminomethyl)indol-2-one |
|---|---|
| PubChem CID | 71477495 |
| Molecular Formula | C22H23ClN6OS |
| Molecular Weight | 454.99 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | (3E)-3-[(3-benzyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)imino]-5-chloro-1-(diethylaminomethyl)indol-2-one |
| SMILES | CCN(CC)CN1C(=O)/C(=N/n2c(Cc3ccccc3)n[nH]c2=S)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C22H23ClN6OS/c1-3-27(4-2)14-28-18-11-10-16(23)13-17(18)20(21(28)30)26-29-19(24-25-22(29)31)12-15-8-6-5-7-9-15/h5-11,13H,3-4,12,14H2,1-2H3,(H,25,31)/b26-20+ |
| InChIKey | YZEIROKDVMGTBG-LHLOQNFPSA-N |
| XLogP | 4.08 |
| TPSA | 69.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.99 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|