C17H28O3 — CID 71478133
ethyl 2-[(2R,6R)-2-cyclohexyl-4,6-dimethyl-2,3-dihydropyran-6-yl]acetate (PubChem CID 71478133) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is ethyl 2-[(2R,6R)-2-cyclohexyl-4,6-dimethyl-2,3-dihydropyran-6-yl]acetate.
| Compound Name | ethyl 2-[(2R,6R)-2-cyclohexyl-4,6-dimethyl-2,3-dihydropyran-6-yl]acetate |
|---|---|
| PubChem CID | 71478133 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | ethyl 2-[(2R,6R)-2-cyclohexyl-4,6-dimethyl-2,3-dihydropyran-6-yl]acetate |
| SMILES | CCOC(=O)C[C@]1(C)C=C(C)C[C@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C17H28O3/c1-4-19-16(18)12-17(3)11-13(2)10-15(20-17)14-8-6-5-7-9-14/h11,14-15H,4-10,12H2,1-3H3/t15-,17+/m1/s1 |
| InChIKey | GPRBCDSZXKJOMC-WBVHZDCISA-N |
| XLogP | 4.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|