C22H26N8O3 — CID 71478218
2,3-dihydro-1,4-benzodioxin-3-yl-[4-[4-[2-(methylamino)ethylamino]pteridin-2-yl]piperazin-1-yl]methanone (PubChem CID 71478218) has the molecular formula C22H26N8O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-3-yl-[4-[4-[2-(methylamino)ethylamino]pteridin-2-yl]piperazin-1-yl]methanone.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-3-yl-[4-[4-[2-(methylamino)ethylamino]pteridin-2-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 71478218 |
| Molecular Formula | C22H26N8O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-3-yl-[4-[4-[2-(methylamino)ethylamino]pteridin-2-yl]piperazin-1-yl]methanone |
| SMILES | CNCCNc1nc(N2CCN(C(=O)C3COc4ccccc4O3)CC2)nc2nccnc12 |
| InChI | InChI=1S/C22H26N8O3/c1-23-6-7-25-19-18-20(26-9-8-24-18)28-22(27-19)30-12-10-29(11-13-30)21(31)17-14-32-15-4-2-3-5-16(15)33-17/h2-5,8-9,17,23H,6-7,10-14H2,1H3,(H,25,26,27,28) |
| InChIKey | MUFYBQJWBDDYMY-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 117.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|