C36H37N3O3 — CID 71478388
1-[[4-[2-(hydroxycarbamoyl)phenyl]phenyl]methyl]-2,3-dimethyl-N-[(1S)-1-(3-propan-2-ylphenyl)ethyl]indole-5-carboxamide (PubChem CID 71478388) has the molecular formula C36H37N3O3 and a molecular weight of 559.71 g/mol. Its IUPAC name is 1-[[4-[2-(hydroxycarbamoyl)phenyl]phenyl]methyl]-2,3-dimethyl-N-[(1S)-1-(3-propan-2-ylphenyl)ethyl]indole-5-carboxamide.
| Compound Name | 1-[[4-[2-(hydroxycarbamoyl)phenyl]phenyl]methyl]-2,3-dimethyl-N-[(1S)-1-(3-propan-2-ylphenyl)ethyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 71478388 |
| Molecular Formula | C36H37N3O3 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | 1-[[4-[2-(hydroxycarbamoyl)phenyl]phenyl]methyl]-2,3-dimethyl-N-[(1S)-1-(3-propan-2-ylphenyl)ethyl]indole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C(=O)NO)cc2)c2ccc(C(=O)N[C@@H](C)c3cccc(C(C)C)c3)cc12 |
| InChI | InChI=1S/C36H37N3O3/c1-22(2)28-9-8-10-29(19-28)24(4)37-35(40)30-17-18-34-33(20-30)23(3)25(5)39(34)21-26-13-15-27(16-14-26)31-11-6-7-12-32(31)36(41)38-42/h6-20,22,24,42H,21H2,1-5H3,(H,37,40)(H,38,41)/t24-/m0/s1 |
| InChIKey | CVCGPWWVROZGTB-DEOSSOPVSA-N |
| XLogP | 7.71 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|