About 1-[(3,4-difluorophenyl)methyl]-3-methylthiourea
1-[(3,4-difluorophenyl)methyl]-3-methylthiourea (PubChem CID 71478479) has the molecular formula C9H10F2N2S
and a molecular weight of 216.26 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-3-methylthiourea.
Molecular Properties
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-3-methylthiourea |
| PubChem CID | 71478479 |
| Molecular Formula | C9H10F2N2S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-3-methylthiourea |
| SMILES | CNC(=S)NCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C9H10F2N2S/c1-12-9(14)13-5-6-2-3-7(10)8(11)4-6/h2-4H,5H2,1H3,(H2,12,13,14) |
| InChIKey | UJKLWNYONDFPMC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3,4-difluorophenyl)methyl]-3-methylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,4-difluorophenyl)methyl]-3-methylthiourea?
The IUPAC name of 1-[(3,4-difluorophenyl)methyl]-3-methylthiourea (CID 71478479) is 1-[(3,4-difluorophenyl)methyl]-3-methylthiourea.
What is the SMILES notation for 1-[(3,4-difluorophenyl)methyl]-3-methylthiourea?
The canonical SMILES for 1-[(3,4-difluorophenyl)methyl]-3-methylthiourea is CNC(=S)NCc1ccc(F)c(F)c1.
What is the InChIKey of 1-[(3,4-difluorophenyl)methyl]-3-methylthiourea?
The InChIKey is UJKLWNYONDFPMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2N2S/c1-12-9(14)13-5-6-2-3-7(10)8(11)4-6/h2-4H,5H2,1H3,(H2,12,13,14).
What are the key properties of 1-[(3,4-difluorophenyl)methyl]-3-methylthiourea?
1-[(3,4-difluorophenyl)methyl]-3-methylthiourea has a molecular weight of 216.26 g/mol, XLogP of 1.56, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-difluorophenyl)methyl]-3-methylthiourea is sourced from PubChem (CID 71478479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).