C25H22FN3O4 — CID 71478863
N-[(1R,2S,3S)-2,3-dihydroxy-2,3-dihydro-1H-inden-1-yl]-8-[(2-fluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 71478863) has the molecular formula C25H22FN3O4 and a molecular weight of 447.47 g/mol. Its IUPAC name is N-[(1R,2S,3S)-2,3-dihydroxy-2,3-dihydro-1H-inden-1-yl]-8-[(2-fluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[(1R,2S,3S)-2,3-dihydroxy-2,3-dihydro-1H-inden-1-yl]-8-[(2-fluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71478863 |
| Molecular Formula | C25H22FN3O4 |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N-[(1R,2S,3S)-2,3-dihydroxy-2,3-dihydro-1H-inden-1-yl]-8-[(2-fluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1nc2c(OCc3ccccc3F)cccn2c1C(=O)N[C@@H]1c2ccccc2[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H22FN3O4/c1-14-21(25(32)28-20-16-8-3-4-9-17(16)22(30)23(20)31)29-12-6-11-19(24(29)27-14)33-13-15-7-2-5-10-18(15)26/h2-12,20,22-23,30-31H,13H2,1H3,(H,28,32)/t20-,22+,23+/m1/s1 |
| InChIKey | QCHZBMLFHACASF-PUHATCMVSA-N |
| XLogP | 3.24 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |