About 2-pyrazin-2-ylpyrazine;ruthenium(2+);isocyanate
2-pyrazin-2-ylpyrazine;ruthenium(2+);isocyanate (PubChem CID 71479114) has the molecular formula C9H6N5ORu+
and a molecular weight of 301.25 g/mol. Its IUPAC name is 2-pyrazin-2-ylpyrazine;ruthenium(2+);isocyanate.
Molecular Properties
| Compound Name | 2-pyrazin-2-ylpyrazine;ruthenium(2+);isocyanate |
| PubChem CID | 71479114 |
| Molecular Formula | C9H6N5ORu+ |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.96 |
| IUPAC Name | 2-pyrazin-2-ylpyrazine;ruthenium(2+);isocyanate |
| SMILES | [N-]=C=O.[Ru+2].c1cnc(-c2cnccn2)cn1 |
| InChI | InChI=1S/C8H6N4.CNO.Ru/c1-3-11-7(5-9-1)8-6-10-2-4-12-8;2-1-3;/h1-6H;;/q;-1;+2 |
| InChIKey | JXOOTKONMUOKFN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 90.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-pyrazin-2-ylpyrazine;ruthenium(2+);isocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrazin-2-ylpyrazine;ruthenium(2+);isocyanate?
The IUPAC name of 2-pyrazin-2-ylpyrazine;ruthenium(2+);isocyanate (CID 71479114) is 2-pyrazin-2-ylpyrazine;ruthenium(2+);isocyanate.
What is the SMILES notation for 2-pyrazin-2-ylpyrazine;ruthenium(2+);isocyanate?
The canonical SMILES for 2-pyrazin-2-ylpyrazine;ruthenium(2+);isocyanate is [N-]=C=O.[Ru+2].c1cnc(-c2cnccn2)cn1.
What is the InChIKey of 2-pyrazin-2-ylpyrazine;ruthenium(2+);isocyanate?
The InChIKey is JXOOTKONMUOKFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4.CNO.Ru/c1-3-11-7(5-9-1)8-6-10-2-4-12-8;2-1-3;/h1-6H;;/q;-1;+2.
What are the key properties of 2-pyrazin-2-ylpyrazine;ruthenium(2+);isocyanate?
2-pyrazin-2-ylpyrazine;ruthenium(2+);isocyanate has a molecular weight of 301.25 g/mol, XLogP of 0.82, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrazin-2-ylpyrazine;ruthenium(2+);isocyanate is sourced from PubChem (CID 71479114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).