C25H25N5O3S — CID 71479398
10-[1-[(2R)-2-hydroxypropanoyl]piperidin-4-yl]-2-(6-methylsulfanyl-3-pyridinyl)pyrido[3,2-c][1,5]naphthyridin-9-one (PubChem CID 71479398) has the molecular formula C25H25N5O3S and a molecular weight of 475.57 g/mol. Its IUPAC name is 10-[1-[(2R)-2-hydroxypropanoyl]piperidin-4-yl]-2-(6-methylsulfanyl-3-pyridinyl)pyrido[3,2-c][1,5]naphthyridin-9-one.
| Compound Name | 10-[1-[(2R)-2-hydroxypropanoyl]piperidin-4-yl]-2-(6-methylsulfanyl-3-pyridinyl)pyrido[3,2-c][1,5]naphthyridin-9-one |
|---|---|
| PubChem CID | 71479398 |
| Molecular Formula | C25H25N5O3S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 10-[1-[(2R)-2-hydroxypropanoyl]piperidin-4-yl]-2-(6-methylsulfanyl-3-pyridinyl)pyrido[3,2-c][1,5]naphthyridin-9-one |
| SMILES | CSc1ccc(-c2ccc3ncc4ccc(=O)n(C5CCN(C(=O)[C@@H](C)O)CC5)c4c3n2)cn1 |
| InChI | InChI=1S/C25H25N5O3S/c1-15(31)25(33)29-11-9-18(10-12-29)30-22(32)8-4-17-14-26-20-6-5-19(28-23(20)24(17)30)16-3-7-21(34-2)27-13-16/h3-8,13-15,18,31H,9-12H2,1-2H3/t15-/m1/s1 |
| InChIKey | OZBAQIQFXNXVRM-OAHLLOKOSA-N |
| XLogP | 3.27 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|