C32H52O6Si2 — CID 71479464
(3aS,4S,5S,5aR,9aS,9bS)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-phenylmethoxy-9b-propyl-9a-trimethylsilyloxy-4,5,5a,6-tetrahydro-3aH-naphtho[1,2-d][1,3]dioxol-9-one (PubChem CID 71479464) has the molecular formula C32H52O6Si2 and a molecular weight of 588.93 g/mol. Its IUPAC name is (3aS,4S,5S,5aR,9aS,9bS)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-phenylmethoxy-9b-propyl-9a-trimethylsilyloxy-4,5,5a,6-tetrahydro-3aH-naphtho[1,2-d][1,3]dioxol-9-one.
| Compound Name | (3aS,4S,5S,5aR,9aS,9bS)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-phenylmethoxy-9b-propyl-9a-trimethylsilyloxy-4,5,5a,6-tetrahydro-3aH-naphtho[1,2-d][1,3]dioxol-9-one |
|---|---|
| PubChem CID | 71479464 |
| Molecular Formula | C32H52O6Si2 |
| Molecular Weight | 588.93 g/mol |
| Exact Mass | 588.33 |
| IUPAC Name | (3aS,4S,5S,5aR,9aS,9bS)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-phenylmethoxy-9b-propyl-9a-trimethylsilyloxy-4,5,5a,6-tetrahydro-3aH-naphtho[1,2-d][1,3]dioxol-9-one |
| SMILES | CCC[C@]12OC(C)(C)O[C@H]1[C@H](OCc1ccccc1)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1CC=CC(=O)[C@]12O[Si](C)(C)C |
| InChI | InChI=1S/C32H52O6Si2/c1-12-21-31-28(35-30(5,6)37-31)27(34-22-23-17-14-13-15-18-23)26(36-40(10,11)29(2,3)4)24-19-16-20-25(33)32(24,31)38-39(7,8)9/h13-18,20,24,26-28H,12,19,21-22H2,1-11H3/t24-,26+,27-,28+,31+,32-/m1/s1 |
| InChIKey | MZZZVFKGYRDTFY-GZDHRZRNSA-N |
| XLogP | 7.40 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.93 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|