C18H30O2 — CID 71479629
2-[(1R,2S)-1,2,5,5-tetramethyl-2,3,4,6,7,8-hexahydronaphthalen-1-yl]ethyl acetate (PubChem CID 71479629) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 2-[(1R,2S)-1,2,5,5-tetramethyl-2,3,4,6,7,8-hexahydronaphthalen-1-yl]ethyl acetate.
| Compound Name | 2-[(1R,2S)-1,2,5,5-tetramethyl-2,3,4,6,7,8-hexahydronaphthalen-1-yl]ethyl acetate |
|---|---|
| PubChem CID | 71479629 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 2-[(1R,2S)-1,2,5,5-tetramethyl-2,3,4,6,7,8-hexahydronaphthalen-1-yl]ethyl acetate |
| SMILES | CC(=O)OCC[C@@]1(C)C2=C(CC[C@@H]1C)C(C)(C)CCC2 |
| InChI | InChI=1S/C18H30O2/c1-13-8-9-15-16(7-6-10-17(15,3)4)18(13,5)11-12-20-14(2)19/h13H,6-12H2,1-5H3/t13-,18+/m0/s1 |
| InChIKey | GLQVMGWXKDASNU-SCLBCKFNSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|