C33H58O3Si2 — CID 71479669
[2,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-[(1R,2S)-1,2,5,5-tetramethyl-2,3,4,6,7,8-hexahydronaphthalen-1-yl]methanol (PubChem CID 71479669) has the molecular formula C33H58O3Si2 and a molecular weight of 559.00 g/mol. Its IUPAC name is [2,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-[(1R,2S)-1,2,5,5-tetramethyl-2,3,4,6,7,8-hexahydronaphthalen-1-yl]methanol.
| Compound Name | [2,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-[(1R,2S)-1,2,5,5-tetramethyl-2,3,4,6,7,8-hexahydronaphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 71479669 |
| Molecular Formula | C33H58O3Si2 |
| Molecular Weight | 559.00 g/mol |
| Exact Mass | 558.39 |
| IUPAC Name | [2,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-[(1R,2S)-1,2,5,5-tetramethyl-2,3,4,6,7,8-hexahydronaphthalen-1-yl]methanol |
| SMILES | C[C@H]1CCC2=C(CCCC2(C)C)[C@]1(C)C(O)c1cc(O[Si](C)(C)C(C)(C)C)ccc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H58O3Si2/c1-23-17-19-26-27(16-15-21-32(26,8)9)33(23,10)29(34)25-22-24(35-37(11,12)30(2,3)4)18-20-28(25)36-38(13,14)31(5,6)7/h18,20,22-23,29,34H,15-17,19,21H2,1-14H3/t23-,29?,33+/m0/s1 |
| InChIKey | ANIJYHXMDGYFOK-DHBGATPCSA-N |
| XLogP | 10.43 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.00 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|