C38H48O6Si — CID 71479687
methyl (2Z)-2-[(2R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(3,3-dimethyl-2-oxo-4-phenylmethoxybutyl)oxan-4-ylidene]acetate (PubChem CID 71479687) has the molecular formula C38H48O6Si and a molecular weight of 628.88 g/mol. Its IUPAC name is methyl (2Z)-2-[(2R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(3,3-dimethyl-2-oxo-4-phenylmethoxybutyl)oxan-4-ylidene]acetate.
| Compound Name | methyl (2Z)-2-[(2R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(3,3-dimethyl-2-oxo-4-phenylmethoxybutyl)oxan-4-ylidene]acetate |
|---|---|
| PubChem CID | 71479687 |
| Molecular Formula | C38H48O6Si |
| Molecular Weight | 628.88 g/mol |
| Exact Mass | 628.32 |
| IUPAC Name | methyl (2Z)-2-[(2R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(3,3-dimethyl-2-oxo-4-phenylmethoxybutyl)oxan-4-ylidene]acetate |
| SMILES | COC(=O)/C=C1/C[C@@H](CC(=O)C(C)(C)COCc2ccccc2)O[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C38H48O6Si/c1-37(2,3)45(33-18-12-8-13-19-33,34-20-14-9-15-21-34)43-27-32-23-30(24-36(40)41-6)22-31(44-32)25-35(39)38(4,5)28-42-26-29-16-10-7-11-17-29/h7-21,24,31-32H,22-23,25-28H2,1-6H3/b30-24-/t31-,32+/m0/s1 |
| InChIKey | SRNJBCLXEQULBA-XQQMYFKOSA-N |
| XLogP | 6.41 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.88 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|