C22H17Cl3F6N2O2 — CID 71479708
2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 71479708) has the molecular formula C22H17Cl3F6N2O2 and a molecular weight of 561.74 g/mol. Its IUPAC name is 2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | 2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 71479708 |
| Molecular Formula | C22H17Cl3F6N2O2 |
| Molecular Weight | 561.74 g/mol |
| Exact Mass | 560.03 |
| IUPAC Name | 2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | Cc1cc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)ccc1C(=O)NCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C22H17Cl3F6N2O2/c1-11-6-12(2-4-14(11)20(35)32-9-18(34)33-10-21(26,27)28)3-5-15(22(29,30)31)13-7-16(23)19(25)17(24)8-13/h2-8,15H,9-10H2,1H3,(H,32,35)(H,33,34)/b5-3+ |
| InChIKey | RUHBOZHRTANHLP-HWKANZROSA-N |
| XLogP | 6.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.74 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|