C14H25NO5 — CID 71479909
ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxan-3-yl)acetate (PubChem CID 71479909) has the molecular formula C14H25NO5 and a molecular weight of 287.36 g/mol. Its IUPAC name is ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxan-3-yl)acetate.
| Compound Name | ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxan-3-yl)acetate |
|---|---|
| PubChem CID | 71479909 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxan-3-yl)acetate |
| SMILES | CCOC(=O)C(NC(=O)OC(C)(C)C)C1CCCOC1 |
| InChI | InChI=1S/C14H25NO5/c1-5-19-12(16)11(10-7-6-8-18-9-10)15-13(17)20-14(2,3)4/h10-11H,5-9H2,1-4H3,(H,15,17) |
| InChIKey | HLKMNWASCUVFNI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |