C21H38O2 — CID 71479982
2-(13,13,14,14-tetradeuteriohexadec-8-ynoxy)oxane (PubChem CID 71479982) has the molecular formula C21H38O2 and a molecular weight of 326.56 g/mol. Its IUPAC name is 2-(13,13,14,14-tetradeuteriohexadec-8-ynoxy)oxane.
| Compound Name | 2-(13,13,14,14-tetradeuteriohexadec-8-ynoxy)oxane |
|---|---|
| PubChem CID | 71479982 |
| Molecular Formula | C21H38O2 |
| Molecular Weight | 326.56 g/mol |
| Exact Mass | 326.31 |
| IUPAC Name | 2-(13,13,14,14-tetradeuteriohexadec-8-ynoxy)oxane |
| SMILES | [2H]C([2H])(CC)C([2H])([2H])CCCC#CCCCCCCCOC1CCCCO1 |
| InChI | InChI=1S/C21H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-22-21-18-15-17-20-23-21/h21H,2-7,10-20H2,1H3/i3D2,4D2 |
| InChIKey | YKVZYOYAJZOFOO-KHORGVISSA-N |
| XLogP | 6.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.56 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|