C20H19N3O4 — CID 71480113
N-[(E)-[(1R,7aR)-1-(furan-3-yl)-4,7a-dimethyl-3-oxo-6,7-dihydro-1H-2-benzofuran-5-ylidene]amino]pyridine-4-carboxamide (PubChem CID 71480113) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is N-[(E)-[(1R,7aR)-1-(furan-3-yl)-4,7a-dimethyl-3-oxo-6,7-dihydro-1H-2-benzofuran-5-ylidene]amino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-[(1R,7aR)-1-(furan-3-yl)-4,7a-dimethyl-3-oxo-6,7-dihydro-1H-2-benzofuran-5-ylidene]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 71480113 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-[(E)-[(1R,7aR)-1-(furan-3-yl)-4,7a-dimethyl-3-oxo-6,7-dihydro-1H-2-benzofuran-5-ylidene]amino]pyridine-4-carboxamide |
| SMILES | CC1=C2C(=O)O[C@@H](c3ccoc3)[C@]2(C)CC/C1=N\NC(=O)c1ccncc1 |
| InChI | InChI=1S/C20H19N3O4/c1-12-15(22-23-18(24)13-4-8-21-9-5-13)3-7-20(2)16(12)19(25)27-17(20)14-6-10-26-11-14/h4-6,8-11,17H,3,7H2,1-2H3,(H,23,24)/b22-15+/t17-,20+/m0/s1 |
| InChIKey | CNIAKCJVZJHIPF-SABPEOHLSA-N |
| XLogP | 3.18 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|