C20H29NO4 — CID 7148036
[2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-(3-methylphenoxy)butanoate (PubChem CID 7148036) has the molecular formula C20H29NO4 and a molecular weight of 347.45 g/mol. Its IUPAC name is [2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-(3-methylphenoxy)butanoate.
| Compound Name | [2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-(3-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 7148036 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | [2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-(3-methylphenoxy)butanoate |
| SMILES | Cc1cccc(OCCCC(=O)OCC(=O)N[C@H]2CCCC[C@H]2C)c1 |
| InChI | InChI=1S/C20H29NO4/c1-15-7-5-9-17(13-15)24-12-6-11-20(23)25-14-19(22)21-18-10-4-3-8-16(18)2/h5,7,9,13,16,18H,3-4,6,8,10-12,14H2,1-2H3,(H,21,22)/t16-,18+/m1/s1 |
| InChIKey | RVSNXWWZGYUGKA-AEFFLSMTSA-N |
| XLogP | 3.39 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|