About (2,4-dichlorophenyl)methyl 2,3-dimethyl-5-nitroimidazole-4-carboxylate
(2,4-dichlorophenyl)methyl 2,3-dimethyl-5-nitroimidazole-4-carboxylate (PubChem CID 714805) has the molecular formula C13H11Cl2N3O4
and a molecular weight of 344.15 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl 2,3-dimethyl-5-nitroimidazole-4-carboxylate.
Molecular Properties
| Compound Name | (2,4-dichlorophenyl)methyl 2,3-dimethyl-5-nitroimidazole-4-carboxylate |
| PubChem CID | 714805 |
| Molecular Formula | C13H11Cl2N3O4 |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | (2,4-dichlorophenyl)methyl 2,3-dimethyl-5-nitroimidazole-4-carboxylate |
| SMILES | Cc1nc([N+](=O)[O-])c(C(=O)OCc2ccc(Cl)cc2Cl)n1C |
| InChI | InChI=1S/C13H11Cl2N3O4/c1-7-16-12(18(20)21)11(17(7)2)13(19)22-6-8-3-4-9(14)5-10(8)15/h3-5H,6H2,1-2H3 |
| InChIKey | KCSHRPGZZCCPOK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dichlorophenyl)methyl 2,3-dimethyl-5-nitroimidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dichlorophenyl)methyl 2,3-dimethyl-5-nitroimidazole-4-carboxylate?
The IUPAC name of (2,4-dichlorophenyl)methyl 2,3-dimethyl-5-nitroimidazole-4-carboxylate (CID 714805) is (2,4-dichlorophenyl)methyl 2,3-dimethyl-5-nitroimidazole-4-carboxylate.
What is the SMILES notation for (2,4-dichlorophenyl)methyl 2,3-dimethyl-5-nitroimidazole-4-carboxylate?
The canonical SMILES for (2,4-dichlorophenyl)methyl 2,3-dimethyl-5-nitroimidazole-4-carboxylate is Cc1nc([N+](=O)[O-])c(C(=O)OCc2ccc(Cl)cc2Cl)n1C.
What is the InChIKey of (2,4-dichlorophenyl)methyl 2,3-dimethyl-5-nitroimidazole-4-carboxylate?
The InChIKey is KCSHRPGZZCCPOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Cl2N3O4/c1-7-16-12(18(20)21)11(17(7)2)13(19)22-6-8-3-4-9(14)5-10(8)15/h3-5H,6H2,1-2H3.
What are the key properties of (2,4-dichlorophenyl)methyl 2,3-dimethyl-5-nitroimidazole-4-carboxylate?
(2,4-dichlorophenyl)methyl 2,3-dimethyl-5-nitroimidazole-4-carboxylate has a molecular weight of 344.15 g/mol, XLogP of 3.30, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dichlorophenyl)methyl 2,3-dimethyl-5-nitroimidazole-4-carboxylate is sourced from PubChem (CID 714805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).