C15H18N6O2 — CID 71480566
1-(cyclopropylmethyl)-6-hydrazinyl-3-(4-pyrazol-1-ylbut-2-ynyl)pyrimidine-2,4-dione (PubChem CID 71480566) has the molecular formula C15H18N6O2 and a molecular weight of 314.35 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-6-hydrazinyl-3-(4-pyrazol-1-ylbut-2-ynyl)pyrimidine-2,4-dione.
| Compound Name | 1-(cyclopropylmethyl)-6-hydrazinyl-3-(4-pyrazol-1-ylbut-2-ynyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 71480566 |
| Molecular Formula | C15H18N6O2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1-(cyclopropylmethyl)-6-hydrazinyl-3-(4-pyrazol-1-ylbut-2-ynyl)pyrimidine-2,4-dione |
| SMILES | NNc1cc(=O)n(CC#CCn2cccn2)c(=O)n1CC1CC1 |
| InChI | InChI=1S/C15H18N6O2/c16-18-13-10-14(22)20(15(23)21(13)11-12-4-5-12)9-2-1-7-19-8-3-6-17-19/h3,6,8,10,12,18H,4-5,7,9,11,16H2 |
| InChIKey | WIPPCZKWZPNKCA-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|