C13H16N2O3S — CID 71480725
(1R,2S,6R,7S)-2,6-dimethyl-5-(1,3-thiazol-2-ylamino)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one (PubChem CID 71480725) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is (1R,2S,6R,7S)-2,6-dimethyl-5-(1,3-thiazol-2-ylamino)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one.
| Compound Name | (1R,2S,6R,7S)-2,6-dimethyl-5-(1,3-thiazol-2-ylamino)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one |
|---|---|
| PubChem CID | 71480725 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (1R,2S,6R,7S)-2,6-dimethyl-5-(1,3-thiazol-2-ylamino)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one |
| SMILES | C[C@@]12C(Nc3nccs3)OC(=O)[C@]1(C)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C13H16N2O3S/c1-12-7-3-4-8(17-7)13(12,2)10(16)18-9(12)15-11-14-5-6-19-11/h5-9H,3-4H2,1-2H3,(H,14,15)/t7-,8+,9?,12+,13-/m0/s1 |
| InChIKey | FRKQCRVPNZLXJM-QVVLXXEWSA-N |
| XLogP | 2.01 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |