C30H41N3O4 — CID 71480900
(4S)-N,4-dicyclohexyl-N-methyl-4-[(2-nitro-5-phenoxyphenyl)methylamino]butanamide (PubChem CID 71480900) has the molecular formula C30H41N3O4 and a molecular weight of 507.68 g/mol. Its IUPAC name is (4S)-N,4-dicyclohexyl-N-methyl-4-[(2-nitro-5-phenoxyphenyl)methylamino]butanamide.
| Compound Name | (4S)-N,4-dicyclohexyl-N-methyl-4-[(2-nitro-5-phenoxyphenyl)methylamino]butanamide |
|---|---|
| PubChem CID | 71480900 |
| Molecular Formula | C30H41N3O4 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.31 |
| IUPAC Name | (4S)-N,4-dicyclohexyl-N-methyl-4-[(2-nitro-5-phenoxyphenyl)methylamino]butanamide |
| SMILES | CN(C(=O)CC[C@H](NCc1cc(Oc2ccccc2)ccc1[N+](=O)[O-])C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C30H41N3O4/c1-32(25-13-7-3-8-14-25)30(34)20-18-28(23-11-5-2-6-12-23)31-22-24-21-27(17-19-29(24)33(35)36)37-26-15-9-4-10-16-26/h4,9-10,15-17,19,21,23,25,28,31H,2-3,5-8,11-14,18,20,22H2,1H3/t28-/m0/s1 |
| InChIKey | VIXDRBDNCMYWFA-NDEPHWFRSA-N |
| XLogP | 7.00 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|