C23H29Cl2N3S — CID 71481162
N'-[2,5-dimethyl-4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide;dihydrochloride (PubChem CID 71481162) has the molecular formula C23H29Cl2N3S and a molecular weight of 450.48 g/mol. Its IUPAC name is N'-[2,5-dimethyl-4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide;dihydrochloride.
| Compound Name | N'-[2,5-dimethyl-4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide;dihydrochloride |
|---|---|
| PubChem CID | 71481162 |
| Molecular Formula | C23H29Cl2N3S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | N'-[2,5-dimethyl-4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide;dihydrochloride |
| SMILES | CCN(C)/C=N/c1cc(C)c(Cc2nc(-c3ccc(C)cc3)cs2)cc1C.Cl.Cl |
| InChI | InChI=1S/C23H27N3S.2ClH/c1-6-26(5)15-24-21-12-17(3)20(11-18(21)4)13-23-25-22(14-27-23)19-9-7-16(2)8-10-19;;/h7-12,14-15H,6,13H2,1-5H3;2*1H/b24-15+;; |
| InChIKey | JWWAVKPTRAYLMF-PCLWTAJYSA-N |
| XLogP | 6.78 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|