C15H29NO3 — CID 71481269
(4S,5R,6Z)-8-[2-(dimethylamino)ethoxy]-3-methoxy-5,7-dimethylocta-1,6-dien-4-ol (PubChem CID 71481269) has the molecular formula C15H29NO3 and a molecular weight of 271.40 g/mol. Its IUPAC name is (4S,5R,6Z)-8-[2-(dimethylamino)ethoxy]-3-methoxy-5,7-dimethylocta-1,6-dien-4-ol.
| Compound Name | (4S,5R,6Z)-8-[2-(dimethylamino)ethoxy]-3-methoxy-5,7-dimethylocta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 71481269 |
| Molecular Formula | C15H29NO3 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | (4S,5R,6Z)-8-[2-(dimethylamino)ethoxy]-3-methoxy-5,7-dimethylocta-1,6-dien-4-ol |
| SMILES | C=CC(OC)[C@@H](O)[C@H](C)/C=C(/C)COCCN(C)C |
| InChI | InChI=1S/C15H29NO3/c1-7-14(18-6)15(17)13(3)10-12(2)11-19-9-8-16(4)5/h7,10,13-15,17H,1,8-9,11H2,2-6H3/b12-10-/t13-,14?,15+/m1/s1 |
| InChIKey | HIMRSWOWIXXETP-VBGUBGJISA-N |
| XLogP | 1.71 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|