C21H25ClN4O3S — CID 71481357
2-chloro-5-[[5-(2-methylpropoxy)-8-nitro-7-phenyl-3,5,6,7-tetrahydro-2H-imidazo[1,2-a]pyridin-1-yl]methyl]-1,3-thiazole (PubChem CID 71481357) has the molecular formula C21H25ClN4O3S and a molecular weight of 448.98 g/mol. Its IUPAC name is 2-chloro-5-[[5-(2-methylpropoxy)-8-nitro-7-phenyl-3,5,6,7-tetrahydro-2H-imidazo[1,2-a]pyridin-1-yl]methyl]-1,3-thiazole.
| Compound Name | 2-chloro-5-[[5-(2-methylpropoxy)-8-nitro-7-phenyl-3,5,6,7-tetrahydro-2H-imidazo[1,2-a]pyridin-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 71481357 |
| Molecular Formula | C21H25ClN4O3S |
| Molecular Weight | 448.98 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 2-chloro-5-[[5-(2-methylpropoxy)-8-nitro-7-phenyl-3,5,6,7-tetrahydro-2H-imidazo[1,2-a]pyridin-1-yl]methyl]-1,3-thiazole |
| SMILES | CC(C)COC1CC(c2ccccc2)C([N+](=O)[O-])=C2N(Cc3cnc(Cl)s3)CCN21 |
| InChI | InChI=1S/C21H25ClN4O3S/c1-14(2)13-29-18-10-17(15-6-4-3-5-7-15)19(26(27)28)20-24(8-9-25(18)20)12-16-11-23-21(22)30-16/h3-7,11,14,17-18H,8-10,12-13H2,1-2H3 |
| InChIKey | SJHNUDJPQLEIDQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.98 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|