C16H25N3O2 — CID 71481431
(4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-(pyrimidin-2-ylmethylamino)octa-1,6-dien-4-ol (PubChem CID 71481431) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is (4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-(pyrimidin-2-ylmethylamino)octa-1,6-dien-4-ol.
| Compound Name | (4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-(pyrimidin-2-ylmethylamino)octa-1,6-dien-4-ol |
|---|---|
| PubChem CID | 71481431 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | (4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-(pyrimidin-2-ylmethylamino)octa-1,6-dien-4-ol |
| SMILES | C=CC(OC)[C@@H](O)[C@H](C)/C=C(/C)CNCc1ncccn1 |
| InChI | InChI=1S/C16H25N3O2/c1-5-14(21-4)16(20)13(3)9-12(2)10-17-11-15-18-7-6-8-19-15/h5-9,13-14,16-17,20H,1,10-11H2,2-4H3/b12-9-/t13-,14?,16+/m1/s1 |
| InChIKey | QPJUXKHMSPWOQD-RGGGDINXSA-N |
| XLogP | 1.71 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|