C15H22N2O3 — CID 71481433
(3S,4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-pyrimidin-2-yloxyocta-1,6-dien-4-ol (PubChem CID 71481433) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is (3S,4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-pyrimidin-2-yloxyocta-1,6-dien-4-ol.
| Compound Name | (3S,4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-pyrimidin-2-yloxyocta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 71481433 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | (3S,4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-pyrimidin-2-yloxyocta-1,6-dien-4-ol |
| SMILES | C=C[C@H](OC)[C@@H](O)[C@H](C)/C=C(/C)COc1ncccn1 |
| InChI | InChI=1S/C15H22N2O3/c1-5-13(19-4)14(18)12(3)9-11(2)10-20-15-16-7-6-8-17-15/h5-9,12-14,18H,1,10H2,2-4H3/b11-9-/t12-,13+,14+/m1/s1 |
| InChIKey | LCURRQBSUIWHCU-ZDCYIQFNSA-N |
| XLogP | 2.00 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|