About (3R,4R)-4-(nitromethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde
(3R,4R)-4-(nitromethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde (PubChem CID 71481448) has the molecular formula C11H11NO4
and a molecular weight of 221.21 g/mol. Its IUPAC name is (3R,4R)-4-(nitromethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde.
Molecular Properties
| Compound Name | (3R,4R)-4-(nitromethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde |
| PubChem CID | 71481448 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | (3R,4R)-4-(nitromethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde |
| SMILES | O=C[C@H]1COc2ccccc2[C@@H]1C[N+](=O)[O-] |
| InChI | InChI=1S/C11H11NO4/c13-6-8-7-16-11-4-2-1-3-9(11)10(8)5-12(14)15/h1-4,6,8,10H,5,7H2/t8-,10+/m0/s1 |
| InChIKey | AXGOWPJFUNQQRT-WCBMZHEXSA-N |
| XLogP | 1.25 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R,4R)-4-(nitromethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-4-(nitromethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde?
The IUPAC name of (3R,4R)-4-(nitromethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde (CID 71481448) is (3R,4R)-4-(nitromethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde.
What is the SMILES notation for (3R,4R)-4-(nitromethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde?
The canonical SMILES for (3R,4R)-4-(nitromethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde is O=C[C@H]1COc2ccccc2[C@@H]1C[N+](=O)[O-].
What is the InChIKey of (3R,4R)-4-(nitromethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde?
The InChIKey is AXGOWPJFUNQQRT-WCBMZHEXSA-N. The full InChI is InChI=1S/C11H11NO4/c13-6-8-7-16-11-4-2-1-3-9(11)10(8)5-12(14)15/h1-4,6,8,10H,5,7H2/t8-,10+/m0/s1.
What are the key properties of (3R,4R)-4-(nitromethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde?
(3R,4R)-4-(nitromethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde has a molecular weight of 221.21 g/mol, XLogP of 1.25, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-4-(nitromethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde is sourced from PubChem (CID 71481448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).