C16H21F3N2O3 — CID 71481598
(3S,4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-[4-(trifluoromethyl)pyrimidin-2-yl]oxyocta-1,6-dien-4-ol (PubChem CID 71481598) has the molecular formula C16H21F3N2O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is (3S,4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-[4-(trifluoromethyl)pyrimidin-2-yl]oxyocta-1,6-dien-4-ol.
| Compound Name | (3S,4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-[4-(trifluoromethyl)pyrimidin-2-yl]oxyocta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 71481598 |
| Molecular Formula | C16H21F3N2O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | (3S,4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-[4-(trifluoromethyl)pyrimidin-2-yl]oxyocta-1,6-dien-4-ol |
| SMILES | C=C[C@H](OC)[C@@H](O)[C@H](C)/C=C(/C)COc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C16H21F3N2O3/c1-5-12(23-4)14(22)11(3)8-10(2)9-24-15-20-7-6-13(21-15)16(17,18)19/h5-8,11-12,14,22H,1,9H2,2-4H3/b10-8-/t11-,12+,14+/m1/s1 |
| InChIKey | GZTZSFBAUULORB-HRDAVYTCSA-N |
| XLogP | 3.02 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|