About CID 71481638
CID 71481638 (PubChem CID 71481638) has the molecular formula C30H33FeN3O3+2
and a molecular weight of 539.46 g/mol.
Molecular Properties
| Compound Name | CID 71481638 |
| PubChem CID | 71481638 |
| Molecular Formula | C30H33FeN3O3+2 |
| Molecular Weight | 539.46 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | — |
| SMILES | O=C(C[C]1[CH][CH][CH][CH]1)N1CCC(C(=O)N2CC(=O)N3CCc4ccccc4C3C2)CC1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C25H28N3O3.C5H5.Fe/c29-23(15-18-5-1-2-6-18)26-12-9-20(10-13-26)25(31)27-16-22-21-8-4-3-7-19(21)11-14-28(22)24(30)17-27;1-2-4-5-3-1;/h1-8,20,22H,9-17H2;1-5H;/q;;+2 |
| InChIKey | MPXXNGUVARDQRD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 539.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 71481638 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71481638?
The IUPAC name of CID 71481638 (CID 71481638) is not available.
What is the SMILES notation for CID 71481638?
The canonical SMILES for CID 71481638 is O=C(C[C]1[CH][CH][CH][CH]1)N1CCC(C(=O)N2CC(=O)N3CCc4ccccc4C3C2)CC1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 71481638?
The InChIKey is MPXXNGUVARDQRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28N3O3.C5H5.Fe/c29-23(15-18-5-1-2-6-18)26-12-9-20(10-13-26)25(31)27-16-22-21-8-4-3-7-19(21)11-14-28(22)24(30)17-27;1-2-4-5-3-1;/h1-8,20,22H,9-17H2;1-5H;/q;;+2.
What are the key properties of CID 71481638?
CID 71481638 has a molecular weight of 539.46 g/mol, XLogP of 3.01, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71481638 is sourced from PubChem (CID 71481638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).